Products 860765-11-3

CAS 860765-11-3 is the registry number for 2-(2-(Piperidin-1-yl)ethoxy)aniline hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 100g, 5g.

Structural formula: {0} (CAS {1})

2-(2-piperidin-1-ylethoxy)aniline;hydrochloride (CAS 860765-11-3) is a chemical compound with the molecular formula C13H21ClN2O and a molecular weight of 256.77 g/mol. IUPAC name: 2-(2-piperidin-1-ylethoxy)aniline;hydrochloride. InChIKey: IRPUITZZSVPMCW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H21ClN2O
Molecular weight256.77 g/mol
IUPAC name2-(2-piperidin-1-ylethoxy)aniline;hydrochloride
InChIKeyIRPUITZZSVPMCW-UHFFFAOYSA-N
SMILESC1CCN(CC1)CCOC2=CC=CC=C2N.Cl

Computed by PubChem (NCBI)