CAS 50295-20-0 appears in our catalog under these names: N-(2,6-Dimethylphenyl)-2-(ethyl(methyl)amino)acetamide hydrochloride, 95+%, Lidocaine Impurity K(EP), Lidocaine Hydrochloride Monohydrate EP Impurity K HCl, Lidocaine EP Impurity K (as Hydrochloride), N-(2,6-Dimethylphenyl)-2-(ethylmethylamino)acetamide Hydrochloride, >95% (HPLC). Offered by: Chemat Brand, Mikromol, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 25mg, 100mg, 10mg, 1mg, 5mg, 10 mg, 5 mg.
N-(2,6-dimethylphenyl)-2-[ethyl(methyl)amino]acetamide;hydrochloride (CAS 50295-20-0) is a chemical compound with the molecular formula C13H21ClN2O and a molecular weight of 256.77 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-2-[ethyl(methyl)amino]acetamide;hydrochloride. InChIKey: APBBVJVUJAPCDX-UHFFFAOYSA-N.
| Molecular formula | C13H21ClN2O |
|---|---|
| Molecular weight | 256.77 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-2-[ethyl(methyl)amino]acetamide;hydrochloride |
| InChIKey | APBBVJVUJAPCDX-UHFFFAOYSA-N |
| SMILES | CCN(C)CC(=O)NC1=C(C=CC=C1C)C.Cl |
Computed by PubChem (NCBI)