Products 878791-35-6
CAS 878791-35-6 appears in our catalog under these names: Prilocaine EP Impurity D HCl, 2-(Propylamino)-N-(m-tolyl)propanamide hydrochloride, 97%, Prilocaine Impurity 4（Prilocaine EP Impurity D）, 2-(Propylamino)-m-propionotoluidide Hydrochloride, (RS)-N-(3-Methyl-phenyl)-2-(propylamino)propanamide Hydrochloride. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 5mg.
N-(3-methylphenyl)-2-(propylamino)propanamide;hydrochloride (CAS 878791-35-6) is a chemical compound with the molecular formula C13H21ClN2O and a molecular weight of 256.77 g/mol. IUPAC name: N-(3-methylphenyl)-2-(propylamino)propanamide;hydrochloride. InChIKey: WHPMFLHCHTWUGB-UHFFFAOYSA-N.
| Molecular formula | C13H21ClN2O |
|---|---|
| Molecular weight | 256.77 g/mol |
| IUPAC name | N-(3-methylphenyl)-2-(propylamino)propanamide;hydrochloride |
| InChIKey | WHPMFLHCHTWUGB-UHFFFAOYSA-N |
| SMILES | CCCNC(C)C(=O)NC1=CC=CC(=C1)C.Cl |
Computed by PubChem (NCBI)