CAS 3594-97-6 appears in our catalog under these names: 2-(2-Hydroxymethylphenyl)phenol, 95%, 2'-(Hydroxymethyl)-(1,1'-biphenyl)-2-ol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2-[2-(hydroxymethyl)phenyl]phenol (CAS 3594-97-6) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 2-[2-(hydroxymethyl)phenyl]phenol. InChIKey: FGCSCCNLDZVFBI-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 2-[2-(hydroxymethyl)phenyl]phenol |
| InChIKey | FGCSCCNLDZVFBI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CO)C2=CC=CC=C2O |
Computed by PubChem (NCBI)