CAS 359629-16-6 appears in our catalog under these names: Boc-Pip(4-AM)*HCl, 1-Boc-4-(Aminomethyl)piperidine HCl 97%, 1-Boc-4-(Aminomethyl)piperidine hydrochloride, 97%, 97%, 1-Boc-4-(Aminomethyl)piperidine hydrochloride, 98.0%, 1-Boc-4-Aminomethyl-piperidine hydrochloride, 97%. Offered by: Iris Biotech, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100g, 100mg, 10g, 25 g.
Tert-butyl 4-(aminomethyl)piperidine-1-carboxylate;hydrochloride (CAS 359629-16-6) is a chemical compound with the molecular formula C11H23ClN2O2 and a molecular weight of 250.76 g/mol. IUPAC name: tert-butyl 4-(aminomethyl)piperidine-1-carboxylate;hydrochloride. InChIKey: DSXFEYYTYBXYMB-UHFFFAOYSA-N.
| Molecular formula | C11H23ClN2O2 |
|---|---|
| Molecular weight | 250.76 g/mol |
| IUPAC name | tert-butyl 4-(aminomethyl)piperidine-1-carboxylate;hydrochloride |
| InChIKey | DSXFEYYTYBXYMB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CN.Cl |
Computed by PubChem (NCBI)