CAS 35975-54-3 is the registry number for 1-Methyl-4-oxo-1,4-dihydroquinoline-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-methyl-4-oxoquinoline-2-carboxylic acid (CAS 35975-54-3) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 1-methyl-4-oxoquinoline-2-carboxylic acid. InChIKey: DZNNIRHFSWTOJH-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 1-methyl-4-oxoquinoline-2-carboxylic acid |
| InChIKey | DZNNIRHFSWTOJH-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=O)C=C1C(=O)O |
Computed by PubChem (NCBI)