Products 3598-30-9
CAS 3598-30-9 appears in our catalog under these names: [1,1'-Biphenyl]-3,3',4,4'-tetraol, 98%, 98%, Biphenyl-3′,3,4,4′-tetrol, 98.31%, 4-(3,4-dihydroxyphenyl)benzene-1,2-diol, 98%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 10mM/1mL, 1 g, 100 mg, 250 mg, 500 mg.
4-(3,4-dihydroxyphenyl)benzene-1,2-diol (CAS 3598-30-9) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: 4-(3,4-dihydroxyphenyl)benzene-1,2-diol. InChIKey: MZEFNGQKJROKHS-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 4-(3,4-dihydroxyphenyl)benzene-1,2-diol |
| InChIKey | MZEFNGQKJROKHS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
[1,1'-Biphenyl]-3,3',4,4'-tetrol, (1,1'-Biphenyl)-3,3',4,4'-tetrol, [1,1'-Biphenyl]-3,3',4,4'-tetraol, 4-(3,4-dihydroxyphenyl)benzene-1,2-diol, 3,3',4,4'-Biphenyltetrol, 3,3',4,4'-Tetrahydroxydiphenyl, 3,4,3',4'-Tetrahydroxy-1,1'-biphenyl, 3,4,4'-Biphenyltetrol, orb2814266, Biphenyl-3',3,4,4'-tetrol