Products 856208-82-7

CAS 856208-82-7 is the registry number for 3-Bromonaphthalen-2-yl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3-bromonaphthalen-2-yl) acetate (CAS 856208-82-7) is a chemical compound with the molecular formula C12H9BrO2 and a molecular weight of 265.10 g/mol. IUPAC name: (3-bromonaphthalen-2-yl) acetate. InChIKey: BBNVKBKQXPWASC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9BrO2
Molecular weight265.10 g/mol
IUPAC name(3-bromonaphthalen-2-yl) acetate
InChIKeyBBNVKBKQXPWASC-UHFFFAOYSA-N
SMILESCC(=O)OC1=CC2=CC=CC=C2C=C1Br

Computed by PubChem (NCBI)