Products 359828-75-4

CAS 359828-75-4 is the registry number for Ethyl 3-oxo-4-phenylhexanoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 3-oxo-4-phenylhexanoate (CAS 359828-75-4) is a chemical compound with the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. IUPAC name: ethyl 3-oxo-4-phenylhexanoate. InChIKey: XSDCHQDUIUELCZ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18O3
Molecular weight234.29 g/mol
IUPAC nameethyl 3-oxo-4-phenylhexanoate
InChIKeyXSDCHQDUIUELCZ-UHFFFAOYSA-N
SMILESCCC(C1=CC=CC=C1)C(=O)CC(=O)OCC

Computed by PubChem (NCBI)