CAS 3601-66-9 appears in our catalog under these names: Boc–DL–Phg–OH, N-Boc-DL-phenylglycine, 98% , Boc-DL-Phg-OH, >98.0%(HPLC)(T), Boc-DL-Phg-OH 98%, Boc-DL-Phg-OH, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 5g, 25g, 1000g, 500g, 10g, 1kg, 100 g.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetic acid (CAS 3601-66-9) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetic acid. InChIKey: HOBFSNNENNQQIU-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetic acid |
| InChIKey | HOBFSNNENNQQIU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)