Products 36044-39-0

CAS 36044-39-0 is the registry number for 1,3-Diethyl 1,3-azulenedicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Diethyl azulene-1,3-dicarboxylate (CAS 36044-39-0) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: diethyl azulene-1,3-dicarboxylate. InChIKey: RVUQIDQFWHDMPK-UHFFFAOYSA-N.

Identity
Molecular formulaC16H16O4
Molecular weight272.29 g/mol
IUPAC namediethyl azulene-1,3-dicarboxylate
InChIKeyRVUQIDQFWHDMPK-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=C2C1=CC=CC=C2)C(=O)OCC

Computed by PubChem (NCBI)