Products 36065-89-1

CAS 36065-89-1 is the registry number for 2-(2-(N-Methylsulfamoyl)phenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[2-(methylsulfamoyl)phenyl]acetic acid (CAS 36065-89-1) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: 2-[2-(methylsulfamoyl)phenyl]acetic acid. InChIKey: VXGHWBHTDJQBCP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO4S
Molecular weight229.26 g/mol
IUPAC name2-[2-(methylsulfamoyl)phenyl]acetic acid
InChIKeyVXGHWBHTDJQBCP-UHFFFAOYSA-N
SMILESCNS(=O)(=O)C1=CC=CC=C1CC(=O)O

Computed by PubChem (NCBI)