Products 360778-44-5
CAS 360778-44-5 appears in our catalog under these names: 3-((3-Chlorophenoxy)methyl)benzoic acid, 95+%, 3-(3-Chlorophenoxymethyl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 2,5g, 250mg.
3-[(3-chlorophenoxy)methyl]benzoic acid (CAS 360778-44-5) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: 3-[(3-chlorophenoxy)methyl]benzoic acid. InChIKey: ONTJAMCYIQODDU-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO3 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 3-[(3-chlorophenoxy)methyl]benzoic acid |
| InChIKey | ONTJAMCYIQODDU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)COC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)