Products 361-63-7
CAS 361-63-7 appears in our catalog under these names: 2,2-Bis(4-fluorophenyl)acetic acid, 95%, 2，2–BIS(4–FLUOROPHENYL)ACETIC ACID, 2,2-Bis(4-fluorophenyl)acetic acid 95%, 2，2-BIS(4-FLUOROPHENYL)ACETIC ACID, 98%, 98%, 2,2-Bis(4-fluorophenyl)acetic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
2,2-bis(4-fluorophenyl)acetic acid (CAS 361-63-7) is a chemical compound with the molecular formula C14H10F2O2 and a molecular weight of 248.22 g/mol. IUPAC name: 2,2-bis(4-fluorophenyl)acetic acid. InChIKey: MCDCIWAVBWPRSP-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O2 |
|---|---|
| Molecular weight | 248.22 g/mol |
| IUPAC name | 2,2-bis(4-fluorophenyl)acetic acid |
| InChIKey | MCDCIWAVBWPRSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)F)C(=O)O)F |
Computed by PubChem (NCBI)