Products 3622-35-3
CAS 3622-35-3 appears in our catalog under these names: Benzothiazole-6-carboxylic acid, Benzothiazole–6–carboxylic acid, Benzothiazole-6-carboxylic acid, 96% , Benzothiazole-6-carboxylic acid, 96%, Benzothiazole-6-carboxylic acid 95%. Offered by: TargetMol, GLPBio, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), Ambeed. Available pack sizes: 1g, 50mg, 100mg, 500mg, 25g, 5g, 250mg, 2.5g.
1,3-benzothiazole-6-carboxylic acid (CAS 3622-35-3) is a chemical compound with the molecular formula C8H5NO2S and a molecular weight of 179.20 g/mol. IUPAC name: 1,3-benzothiazole-6-carboxylic acid. InChIKey: DMPZJACLHDWUFS-UHFFFAOYSA-N.
| Molecular formula | C8H5NO2S |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | 1,3-benzothiazole-6-carboxylic acid |
| InChIKey | DMPZJACLHDWUFS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)SC=N2 |
Computed by PubChem (NCBI)