CAS 362529-02-0 is the registry number for [4-(3-Methyl-1,2,4-oxadiazol-5-yl)phenyl]methanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methanol (CAS 362529-02-0) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: [4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methanol. InChIKey: OFHPDFFUEDRYNK-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | [4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methanol |
| InChIKey | OFHPDFFUEDRYNK-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)C2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)