CAS 36364-49-5 appears in our catalog under these names: Imidazole Salicylate, Imidazole salicylate (Standard). Offered by: Mikromol, MedChemExpress. Available pack sizes: 100mg, Get quote.
2-hydroxybenzoic acid;1H-imidazole (CAS 36364-49-5) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: 2-hydroxybenzoic acid;1H-imidazole. InChIKey: XCHHJFVNQPPLJK-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | 2-hydroxybenzoic acid;1H-imidazole |
| InChIKey | XCHHJFVNQPPLJK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)O.C1=CN=CN1 |
Computed by PubChem (NCBI)