Products 36413-91-9
CAS 36413-91-9 is the registry number for Geiparvarin. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[(E)-3-(5,5-dimethyl-4-oxofuran-2-yl)but-2-enoxy]chromen-2-one (CAS 36413-91-9) is a chemical compound with the molecular formula C19H18O5 and a molecular weight of 326.3 g/mol. IUPAC name: 7-[(E)-3-(5,5-dimethyl-4-oxofuran-2-yl)but-2-enoxy]chromen-2-one. InChIKey: OUTLLBZGJYDUQE-XYOKQWHBSA-N.
| Molecular formula | C19H18O5 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | 7-[(E)-3-(5,5-dimethyl-4-oxofuran-2-yl)but-2-enoxy]chromen-2-one |
| InChIKey | OUTLLBZGJYDUQE-XYOKQWHBSA-N |
| SMILES | C/C(=C\COC1=CC2=C(C=C1)C=CC(=O)O2)/C3=CC(=O)C(O3)(C)C |
Computed by PubChem (NCBI)