Products 36622-24-9
CAS 36622-24-9 is the registry number for (S)-(-)-Verapamilic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 5mg.
(4S)-4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexanoic acid (CAS 36622-24-9) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: (4S)-4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexanoic acid. InChIKey: BSHCLIANLKRGLY-INIZCTEOSA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | (4S)-4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexanoic acid |
| InChIKey | BSHCLIANLKRGLY-INIZCTEOSA-N |
| SMILES | CC(C)[C@](CCC(=O)O)(C#N)C1=CC(=C(C=C1)OC)OC |
Computed by PubChem (NCBI)