Products 38175-99-4
CAS 38175-99-4 is the registry number for (R)-(+)-Verapamilic Acid. Offered by: TRC. Available pack sizes: 10mg, 5mg.
(4R)-4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexanoic acid (CAS 38175-99-4) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: (4R)-4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexanoic acid. InChIKey: BSHCLIANLKRGLY-MRXNPFEDSA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | (4R)-4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexanoic acid |
| InChIKey | BSHCLIANLKRGLY-MRXNPFEDSA-N |
| SMILES | CC(C)[C@@](CCC(=O)O)(C#N)C1=CC(=C(C=C1)OC)OC |
Computed by PubChem (NCBI)