CAS 3663-38-5 appears in our catalog under these names: 3-(4-Methylphenyl)-1,2,4-oxadiazol-5-amine, 3-(4-Methylphenyl)-1,2,4-oxadiazol-5-amine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.
3-(4-methylphenyl)-1,2,4-oxadiazol-5-amine (CAS 3663-38-5) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 3-(4-methylphenyl)-1,2,4-oxadiazol-5-amine. InChIKey: KDFPLANNPDPZTN-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 3-(4-methylphenyl)-1,2,4-oxadiazol-5-amine |
| InChIKey | KDFPLANNPDPZTN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NOC(=N2)N |
Computed by PubChem (NCBI)