CAS 3690-95-7 is the registry number for 3-(2-Hydroxyethyl)indolin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-hydroxyethyl)-1,3-dihydroindol-2-one (CAS 3690-95-7) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 3-(2-hydroxyethyl)-1,3-dihydroindol-2-one. InChIKey: DBCZFYRBPSLGDS-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 3-(2-hydroxyethyl)-1,3-dihydroindol-2-one |
| InChIKey | DBCZFYRBPSLGDS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C(=O)N2)CCO |
Computed by PubChem (NCBI)