CAS 36983-38-7 appears in our catalog under these names: a,g-Dioxo-2-naphthalenebutanoic acid ethyl ester, 95%, Ethyl 4-(naphthalen-2-yl)-2,4-dioxobutanoate, Ethyl 4-(naphthalen-2-yl)-2,4-dioxobutanoate, 95%, 95%, ethyl 2-hydroxy-4-(naphthalen-2-yl)-4-oxobut-2-enoate, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 10g, 2,5g, 250mg, 100mg, 1g, 500mg.
Ethyl 4-naphthalen-2-yl-2,4-dioxobutanoate (CAS 36983-38-7) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: ethyl 4-naphthalen-2-yl-2,4-dioxobutanoate. InChIKey: PCCOLZYMAYSQQQ-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | ethyl 4-naphthalen-2-yl-2,4-dioxobutanoate |
| InChIKey | PCCOLZYMAYSQQQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=CC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)