CAS 3705-80-4 appears in our catalog under these names: 7-Ethoxy-3-oxo-3H-phenoxazine 10-oxide, 98%, 7-Ethoxyresorufin N-Oxide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 5mg.
7-ethoxy-10-oxidophenoxazin-10-ium-3-one (CAS 3705-80-4) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 7-ethoxy-10-oxidophenoxazin-10-ium-3-one. InChIKey: XWPCTJAXIHCATC-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 7-ethoxy-10-oxidophenoxazin-10-ium-3-one |
| InChIKey | XWPCTJAXIHCATC-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)[N+](=C3C=CC(=O)C=C3O2)[O-] |
Computed by PubChem (NCBI)