CAS 37055-79-1 appears in our catalog under these names: 2-Methoxy-4-phenylphenol, 98%, 3-Methoxy-(1,1'-biphenyl)-4-ol, 98%, 2-Methoxy-4-phenylphenol, 98%, 98%, 3-Methoxy-[1,1'-biphenyl]-4-ol, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-methoxy-4-phenylphenol (CAS 37055-79-1) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 2-methoxy-4-phenylphenol. InChIKey: HJFNQXYLCLOQJK-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 2-methoxy-4-phenylphenol |
| InChIKey | HJFNQXYLCLOQJK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=CC=CC=C2)O |
Computed by PubChem (NCBI)