CAS 37055-80-4 appears in our catalog under these names: 4-Methoxy-[1,1'-biphenyl]-3-ol 98%, [1,1'-Biphenyl]-3-ol, 4-methoxy-, 95%, 95%, 2-Methoxy-5-phenylphenol, 97%, 2-Methoxy-5-phenylphenol, 95%. Offered by: Ambeed, Chemat, Combi-blocks, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-methoxy-5-phenylphenol (CAS 37055-80-4) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 2-methoxy-5-phenylphenol. InChIKey: HKJUJKFXUPMEKB-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 2-methoxy-5-phenylphenol |
| InChIKey | HKJUJKFXUPMEKB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC=CC=C2)O |
Computed by PubChem (NCBI)