CAS 370872-09-6 appears in our catalog under these names: 5-Benzoyloxy-1(2H)-isoquinolinone, UPF-1035. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 5 mg, 10 mg, 25 mg.
(1-oxo-2H-isoquinolin-5-yl) benzoate (CAS 370872-09-6) is a chemical compound with the molecular formula C16H11NO3 and a molecular weight of 265.26 g/mol. IUPAC name: (1-oxo-2H-isoquinolin-5-yl) benzoate. InChIKey: FFWUPFYTTMMSTH-UHFFFAOYSA-N.
| Molecular formula | C16H11NO3 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | (1-oxo-2H-isoquinolin-5-yl) benzoate |
| InChIKey | FFWUPFYTTMMSTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=CC=CC3=C2C=CNC3=O |
Computed by PubChem (NCBI)