CAS 848593-18-0 is the registry number for (1S,5R)-3-Benzyl 6-tert-butyl 3,6-diazabicyclo[3.2.0]heptane-3,6-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
3-O-benzyl 6-O-tert-butyl (1S,5R)-3,6-diazabicyclo[3.2.0]heptane-3,6-dicarboxylate (CAS 848593-18-0) is a chemical compound with the molecular formula C18H24N2O4 and a molecular weight of 332.4 g/mol. IUPAC name: 3-O-benzyl 6-O-tert-butyl (1S,5R)-3,6-diazabicyclo[3.2.0]heptane-3,6-dicarboxylate. InChIKey: GXIZSOVZVRKXEC-GJZGRUSLSA-N.
| Molecular formula | C18H24N2O4 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 3-O-benzyl 6-O-tert-butyl (1S,5R)-3,6-diazabicyclo[3.2.0]heptane-3,6-dicarboxylate |
| InChIKey | GXIZSOVZVRKXEC-GJZGRUSLSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2[C@@H]1CN(C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)