CAS 3709-21-5 is the registry number for 2-Phenethylmalonic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(2-phenylethyl)propanedioic acid (CAS 3709-21-5) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 2-(2-phenylethyl)propanedioic acid. InChIKey: IUZIGXNXWJEZLU-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 2-(2-phenylethyl)propanedioic acid |
| InChIKey | IUZIGXNXWJEZLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)