Products 37126-91-3
CAS 37126-91-3 is the registry number for Murrangatin. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 500mg, 5mg, 25mg, 10mg, 50mg, Get quote.
8-[(1S,2R)-1,2-dihydroxy-3-methylbut-3-enyl]-7-methoxychromen-2-one (CAS 37126-91-3) is a chemical compound with the molecular formula C15H16O5 and a molecular weight of 276.28 g/mol. IUPAC name: 8-[(1S,2R)-1,2-dihydroxy-3-methylbut-3-enyl]-7-methoxychromen-2-one. InChIKey: DKEANOQWICTXTP-KGLIPLIRSA-N.
| Molecular formula | C15H16O5 |
|---|---|
| Molecular weight | 276.28 g/mol |
| IUPAC name | 8-[(1S,2R)-1,2-dihydroxy-3-methylbut-3-enyl]-7-methoxychromen-2-one |
| InChIKey | DKEANOQWICTXTP-KGLIPLIRSA-N |
| SMILES | CC(=C)[C@H]([C@H](C1=C(C=CC2=C1OC(=O)C=C2)OC)O)O |
Computed by PubChem (NCBI)