CAS 37174-74-6 appears in our catalog under these names: 2-(3-Nitrophenyl)benzoic acid, 98%, 3'-Nitro-(1,1'-biphenyl)-2-carboxylic acid, 95-<97%, 3'-Nitro-(1,1'-biphenyl)-2-carboxylic acid, ≥97-<99%, 2-(3-Nitrophenyl)benzoic acid. Offered by: Combi-blocks, Hoffman Fine Chemicals, Biosynth. Available pack sizes: 5g, 1g, 25g, 50g, 100g, 0,5g, 2g.
2-(3-nitrophenyl)benzoic acid (CAS 37174-74-6) is a chemical compound with the molecular formula C13H9NO4 and a molecular weight of 243.21 g/mol. IUPAC name: 2-(3-nitrophenyl)benzoic acid. InChIKey: LGZSDFBCFHDCKP-UHFFFAOYSA-N.
| Molecular formula | C13H9NO4 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 2-(3-nitrophenyl)benzoic acid |
| InChIKey | LGZSDFBCFHDCKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)