Products 371981-22-5
CAS 371981-22-5 is the registry number for 4-(2,6-Dichlorophenyl)piperidine-2,6-dione. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
4-(2,6-dichlorophenyl)piperidine-2,6-dione (CAS 371981-22-5) is a chemical compound with the molecular formula C11H9Cl2NO2 and a molecular weight of 258.10 g/mol. IUPAC name: 4-(2,6-dichlorophenyl)piperidine-2,6-dione. InChIKey: GNZJINUQGHMRLQ-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2NO2 |
|---|---|
| Molecular weight | 258.10 g/mol |
| IUPAC name | 4-(2,6-dichlorophenyl)piperidine-2,6-dione |
| InChIKey | GNZJINUQGHMRLQ-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)NC1=O)C2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)