CAS 3722-56-3 is the registry number for (S)-4',7-Dimethyl Equol. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg.
(3S)-7-methoxy-3-(4-methoxyphenyl)-3,4-dihydro-2H-chromene (CAS 3722-56-3) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: (3S)-7-methoxy-3-(4-methoxyphenyl)-3,4-dihydro-2H-chromene. InChIKey: GQMFGWWADOSNMX-CQSZACIVSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | (3S)-7-methoxy-3-(4-methoxyphenyl)-3,4-dihydro-2H-chromene |
| InChIKey | GQMFGWWADOSNMX-CQSZACIVSA-N |
| SMILES | COC1=CC=C(C=C1)[C@@H]2CC3=C(C=C(C=C3)OC)OC2 |
Computed by PubChem (NCBI)