Products 37479-76-8

CAS 37479-76-8 is the registry number for Ethyl 4-chloro-5-formyl-2-methyl-3-thiophenecarboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Ethyl 4-chloro-5-formyl-2-methylthiophene-3-carboxylate (CAS 37479-76-8) is a chemical compound with the molecular formula C9H9ClO3S and a molecular weight of 232.68 g/mol. IUPAC name: ethyl 4-chloro-5-formyl-2-methylthiophene-3-carboxylate. InChIKey: NYXNWKHMSRYHAE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClO3S
Molecular weight232.68 g/mol
IUPAC nameethyl 4-chloro-5-formyl-2-methylthiophene-3-carboxylate
InChIKeyNYXNWKHMSRYHAE-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(SC(=C1Cl)C=O)C

Computed by PubChem (NCBI)