CAS 37479-76-8 is the registry number for Ethyl 4-chloro-5-formyl-2-methyl-3-thiophenecarboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Ethyl 4-chloro-5-formyl-2-methylthiophene-3-carboxylate (CAS 37479-76-8) is a chemical compound with the molecular formula C9H9ClO3S and a molecular weight of 232.68 g/mol. IUPAC name: ethyl 4-chloro-5-formyl-2-methylthiophene-3-carboxylate. InChIKey: NYXNWKHMSRYHAE-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3S |
|---|---|
| Molecular weight | 232.68 g/mol |
| IUPAC name | ethyl 4-chloro-5-formyl-2-methylthiophene-3-carboxylate |
| InChIKey | NYXNWKHMSRYHAE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1Cl)C=O)C |
Computed by PubChem (NCBI)