CAS 37526-68-4 is the registry number for 1,3,4,5-Tetrahydro-8-hydroxy-2H-3-benzazepin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-hydroxy-1,2,3,5-tetrahydro-3-benzazepin-4-one (CAS 37526-68-4) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 7-hydroxy-1,2,3,5-tetrahydro-3-benzazepin-4-one. InChIKey: LFDYHVHOUPBVDP-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 7-hydroxy-1,2,3,5-tetrahydro-3-benzazepin-4-one |
| InChIKey | LFDYHVHOUPBVDP-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)CC2=C1C=CC(=C2)O |
Computed by PubChem (NCBI)