CAS 37540-59-3 appears in our catalog under these names: Ethyl 5-bromo-2-hydroxybenzoate, 95%, Ethyl 5-bromo-2-hydroxybenzoate 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g.
Ethyl 5-bromo-2-hydroxybenzoate (CAS 37540-59-3) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: ethyl 5-bromo-2-hydroxybenzoate. InChIKey: OGILVZCKMMXBJI-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | ethyl 5-bromo-2-hydroxybenzoate |
| InChIKey | OGILVZCKMMXBJI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)Br)O |
Computed by PubChem (NCBI)