CAS 376346-53-1 is the registry number for (E)-3-(4-Methoxyphenyl)but-2-enoic acid, 98+%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
(E)-3-(4-methoxyphenyl)but-2-enoic acid (CAS 376346-53-1) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: (E)-3-(4-methoxyphenyl)but-2-enoic acid. InChIKey: FUINODAYLGQWJL-BQYQJAHWSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | (E)-3-(4-methoxyphenyl)but-2-enoic acid |
| InChIKey | FUINODAYLGQWJL-BQYQJAHWSA-N |
| SMILES | C/C(=C\C(=O)O)/C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)