CAS 3769-41-3 appears in our catalog under these names: 3-(Benzyloxy)phenol 96%, 3-(Benzyloxy)phenol, 95%, 3-(Benzyloxy)phenol, >95.0%(GC), 3-(Benzyloxy)phenol, 98%, 98%. Offered by: Ambeed, Fluorochem, TCI, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg.
3-phenylmethoxyphenol (CAS 3769-41-3) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 3-phenylmethoxyphenol. InChIKey: FOTVZLOJAIEAOY-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 3-phenylmethoxyphenol |
| InChIKey | FOTVZLOJAIEAOY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)O |
Computed by PubChem (NCBI)