CAS 37707-72-5 is the registry number for 1-(6,7-Dimethoxynaphthalen-2-yl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(6,7-dimethoxynaphthalen-2-yl)ethanone (CAS 37707-72-5) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: 1-(6,7-dimethoxynaphthalen-2-yl)ethanone. InChIKey: MBERCTJMXDKBID-UHFFFAOYSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 1-(6,7-dimethoxynaphthalen-2-yl)ethanone |
| InChIKey | MBERCTJMXDKBID-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=CC(=C(C=C2C=C1)OC)OC |
Computed by PubChem (NCBI)