CAS 37707-78-1 is the registry number for 6,7-Dimethoxynaphthalene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6,7-dimethoxynaphthalene-2-carboxylic acid (CAS 37707-78-1) is a chemical compound with the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. IUPAC name: 6,7-dimethoxynaphthalene-2-carboxylic acid. InChIKey: XMOYHYGPKOVFJI-UHFFFAOYSA-N.
| Molecular formula | C13H12O4 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 6,7-dimethoxynaphthalene-2-carboxylic acid |
| InChIKey | XMOYHYGPKOVFJI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C=C(C=CC2=C1)C(=O)O)OC |
Computed by PubChem (NCBI)