CAS 377731-29-8 appears in our catalog under these names: 3-(tert-Butyl)-5-(methoxycarbonyl)benzoic acid, 97%, 5-tert-Butyl-isophthalic acid monomethyl ester, 3-(tert-Butyl)-5-(methoxycarbonyl)benzoic acid, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 50mg, 0,5g, 100mg, 250mg.
3-tert-butyl-5-methoxycarbonylbenzoic acid (CAS 377731-29-8) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: 3-tert-butyl-5-methoxycarbonylbenzoic acid. InChIKey: KUPYAQNSGMRTJB-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 3-tert-butyl-5-methoxycarbonylbenzoic acid |
| InChIKey | KUPYAQNSGMRTJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)C(=O)OC)C(=O)O |
Computed by PubChem (NCBI)