Products 377769-55-6
CAS 377769-55-6 appears in our catalog under these names: 3-(4-Butyl-phenylsulfamoyl)-benzoic acid, 95%, 3-((4-Butylphenyl)sulfamoyl)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 0,5g.
3-[(4-butylphenyl)sulfamoyl]benzoic acid (CAS 377769-55-6) is a chemical compound with the molecular formula C17H19NO4S and a molecular weight of 333.4 g/mol. IUPAC name: 3-[(4-butylphenyl)sulfamoyl]benzoic acid. InChIKey: VCKYVPWUFMIGPP-UHFFFAOYSA-N.
| Molecular formula | C17H19NO4S |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 3-[(4-butylphenyl)sulfamoyl]benzoic acid |
| InChIKey | VCKYVPWUFMIGPP-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC=C(C=C1)NS(=O)(=O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)