CAS 37777-77-8 appears in our catalog under these names: 2-(2-Bromo-6-chlorophenyl)acetic Acid, >95% (HPLC), 2–(2–Bromo–6–chlorophenyl)acetic acid, 2-(2-Bromo-6-chlorophenyl)acetic acid, 2-(2-Bromo-6-chlorophenyl)acetic acid 97%, 2-(2-Bromo-6-chlorophenyl)acetic acid, 97%, 97%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 10mg, 50mg, 2,5g, 250mg, 1g, 5g, 25g.
2-(2-bromo-6-chlorophenyl)acetic acid (CAS 37777-77-8) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 2-(2-bromo-6-chlorophenyl)acetic acid. InChIKey: KTPDPINDCZGYEC-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 2-(2-bromo-6-chlorophenyl)acetic acid |
| InChIKey | KTPDPINDCZGYEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)CC(=O)O)Cl |
Computed by PubChem (NCBI)