Products 37779-49-0
CAS 37779-49-0 appears in our catalog under these names: 3-Oxo-4-phenylbutyric acid methyl ester, 98%, Methyl 3-Oxo-4-phenylbutyrate (mixture of isomers), >96.0%(GC), Methyl 3-oxo-4-phenylbutanoate, 95%, 95%, 3-Oxo-4-phenyl-butyric acid methyl ester, 95%. Offered by: Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 100g, 250mg.
Methyl 3-oxo-4-phenylbutanoate (CAS 37779-49-0) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: methyl 3-oxo-4-phenylbutanoate. InChIKey: DTMSEOVTDVSPDO-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | methyl 3-oxo-4-phenylbutanoate |
| InChIKey | DTMSEOVTDVSPDO-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)CC1=CC=CC=C1 |
Computed by PubChem (NCBI)
Synonyms:
methyl 3-oxo-4-phenylbutanoate, 3-Oxo-4-phenyl-butyric acid methyl ester, 3-oxo-4-phenylbutyric acid methyl ester, methyl 3-oxo-4-phenylbutyrate, methyl 4-phenyl-3-oxobutyrate, 4-Phenylacetoacetic Acid Methyl Ester, Methyl 4-Phenylacetoacetate, methyl gamma-phenylacetoacetate, DTMSEOVTDVSPDO-UHFFFAOYSA-N, b-Oxo-benzenebutanoic acid methyl ester