Products 37784-23-9
CAS 37784-23-9 is the registry number for (αR)-α-(Acetylamino)-4-hydroxybenzeneacetic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2R)-2-acetamido-2-(4-hydroxyphenyl)acetic acid (CAS 37784-23-9) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: (2R)-2-acetamido-2-(4-hydroxyphenyl)acetic acid. InChIKey: UVJQJJCJNQDKIY-SECBINFHSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | (2R)-2-acetamido-2-(4-hydroxyphenyl)acetic acid |
| InChIKey | UVJQJJCJNQDKIY-SECBINFHSA-N |
| SMILES | CC(=O)N[C@H](C1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)