CAS 37885-41-9 appears in our catalog under these names: 2',4'–Dichloropropiophenone, 2',4'-Dichloropropiophenone, 2',4'-Dichloropropiophenone, >97.0%(GC), 1-(2,4-Dichlorophenyl)propan-1-one 97%. Offered by: GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 100g, 25g, 5g, 10g, 500g.
1-(2,4-dichlorophenyl)propan-1-one (CAS 37885-41-9) is a chemical compound with the molecular formula C9H8Cl2O and a molecular weight of 203.06 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)propan-1-one. InChIKey: FBMTWRZQBRHOPF-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O |
|---|---|
| Molecular weight | 203.06 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)propan-1-one |
| InChIKey | FBMTWRZQBRHOPF-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)