Products 37893-94-0
CAS 37893-94-0 is the registry number for 2,2'-(Ethane-1,2-diylidenebis(azanylylidene))bis(4-methylphenol), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(2-hydroxy-5-methylphenyl)iminoethylideneamino]-4-methylphenol (CAS 37893-94-0) is a chemical compound with the molecular formula C16H16N2O2 and a molecular weight of 268.31 g/mol. IUPAC name: 2-[2-(2-hydroxy-5-methylphenyl)iminoethylideneamino]-4-methylphenol. InChIKey: OCAJUDPANDEMCR-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O2 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | 2-[2-(2-hydroxy-5-methylphenyl)iminoethylideneamino]-4-methylphenol |
| InChIKey | OCAJUDPANDEMCR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)O)N=CC=NC2=C(C=CC(=C2)C)O |
Computed by PubChem (NCBI)