CAS 37936-89-3 appears in our catalog under these names: (S)-Norfenfluramine Hydrochloride, (+)–Norfenfluramine hydrochloride, (+)-Norfenfluramine (hydrochloride), 99.77%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 250mg, 25mg, 10mg, 5mg, 50mg, 25 mg, 50 mg, 5 mg.
(2S)-1-[3-(trifluoromethyl)phenyl]propan-2-amine;hydrochloride (CAS 37936-89-3) is a chemical compound with the molecular formula C10H13ClF3N and a molecular weight of 239.66 g/mol. IUPAC name: (2S)-1-[3-(trifluoromethyl)phenyl]propan-2-amine;hydrochloride. InChIKey: PIDLOFBRTWNFAR-FJXQXJEOSA-N.
| Molecular formula | C10H13ClF3N |
|---|---|
| Molecular weight | 239.66 g/mol |
| IUPAC name | (2S)-1-[3-(trifluoromethyl)phenyl]propan-2-amine;hydrochloride |
| InChIKey | PIDLOFBRTWNFAR-FJXQXJEOSA-N |
| SMILES | C[C@@H](CC1=CC(=CC=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)