CAS 41538-52-7 is the registry number for (R)-Norfenfluramine Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
(2R)-1-[3-(trifluoromethyl)phenyl]propan-2-amine;hydrochloride (CAS 41538-52-7) is a chemical compound with the molecular formula C10H13ClF3N and a molecular weight of 239.66 g/mol. IUPAC name: (2R)-1-[3-(trifluoromethyl)phenyl]propan-2-amine;hydrochloride. InChIKey: PIDLOFBRTWNFAR-OGFXRTJISA-N.
| Molecular formula | C10H13ClF3N |
|---|---|
| Molecular weight | 239.66 g/mol |
| IUPAC name | (2R)-1-[3-(trifluoromethyl)phenyl]propan-2-amine;hydrochloride |
| InChIKey | PIDLOFBRTWNFAR-OGFXRTJISA-N |
| SMILES | C[C@H](CC1=CC(=CC=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)