Products 380636-42-0

CAS 380636-42-0 is the registry number for rac 6-Methoxycarbonyl-4-phenyl-3,4-dihydrocoumarin. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.

Structural formula: {0} (CAS {1})

Methyl 2-oxo-4-phenyl-3,4-dihydrochromene-6-carboxylate (CAS 380636-42-0) is a chemical compound with the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. IUPAC name: methyl 2-oxo-4-phenyl-3,4-dihydrochromene-6-carboxylate. InChIKey: KJRRDCSIUBYJLB-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14O4
Molecular weight282.29 g/mol
IUPAC namemethyl 2-oxo-4-phenyl-3,4-dihydrochromene-6-carboxylate
InChIKeyKJRRDCSIUBYJLB-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC2=C(C=C1)OC(=O)CC2C3=CC=CC=C3

Computed by PubChem (NCBI)