CAS 380636-42-0 is the registry number for rac 6-Methoxycarbonyl-4-phenyl-3,4-dihydrocoumarin. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
Methyl 2-oxo-4-phenyl-3,4-dihydrochromene-6-carboxylate (CAS 380636-42-0) is a chemical compound with the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. IUPAC name: methyl 2-oxo-4-phenyl-3,4-dihydrochromene-6-carboxylate. InChIKey: KJRRDCSIUBYJLB-UHFFFAOYSA-N.
| Molecular formula | C17H14O4 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | methyl 2-oxo-4-phenyl-3,4-dihydrochromene-6-carboxylate |
| InChIKey | KJRRDCSIUBYJLB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)OC(=O)CC2C3=CC=CC=C3 |
Computed by PubChem (NCBI)